C22H19ClN6O6 — CID 68720793
4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]prop-2-enoyl]amino]-4-methoxy-4-oxobutanoyl]amino]benzoic acid (PubChem CID 68720793) has the molecular formula C22H19ClN6O6 and a molecular weight of 498.88 g/mol. Its IUPAC name is 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]prop-2-enoyl]amino]-4-methoxy-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]prop-2-enoyl]amino]-4-methoxy-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68720793 |
| Molecular Formula | C22H19ClN6O6 |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]prop-2-enoyl]amino]-4-methoxy-4-oxobutanoyl]amino]benzoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)/C=C/c1cc(Cl)ccc1-c1nn[nH]n1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H19ClN6O6/c1-35-19(31)11-17(21(32)24-15-6-2-12(3-7-15)22(33)34)25-18(30)9-4-13-10-14(23)5-8-16(13)20-26-28-29-27-20/h2-10,17H,11H2,1H3,(H,24,32)(H,25,30)(H,33,34)(H,26,27,28,29)/b9-4+/t17-/m0/s1 |
| InChIKey | MCPRSLBTPVHTMF-QVNOTHCHSA-N |
| XLogP | 1.92 |
| TPSA | 176.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|