C16H14ClFN4 — CID 68721011
N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-5-fluoro-4-methylpyridin-2-amine (PubChem CID 68721011) has the molecular formula C16H14ClFN4 and a molecular weight of 316.77 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-5-fluoro-4-methylpyridin-2-amine.
| Compound Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-5-fluoro-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 68721011 |
| Molecular Formula | C16H14ClFN4 |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-5-fluoro-4-methylpyridin-2-amine |
| SMILES | Cc1cc(NCc2cn[nH]c2-c2ccc(Cl)cc2)ncc1F |
| InChI | InChI=1S/C16H14ClFN4/c1-10-6-15(20-9-14(10)18)19-7-12-8-21-22-16(12)11-2-4-13(17)5-3-11/h2-6,8-9H,7H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | VHBUSQJBHKCMFZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |