C17H24O3 — CID 68722884
methoxymethyl 1-benzyl-2,2,3,3-tetramethylcyclopropane-1-carboxylate (PubChem CID 68722884) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is methoxymethyl 1-benzyl-2,2,3,3-tetramethylcyclopropane-1-carboxylate.
| Compound Name | methoxymethyl 1-benzyl-2,2,3,3-tetramethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 68722884 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | methoxymethyl 1-benzyl-2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| SMILES | COCOC(=O)C1(Cc2ccccc2)C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H24O3/c1-15(2)16(3,4)17(15,14(18)20-12-19-5)11-13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3 |
| InChIKey | ZJPMSWLLTOHZNF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|