C15H19ClF3N3O3 — CID 68743031
3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 68743031) has the molecular formula C15H19ClF3N3O3 and a molecular weight of 381.78 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 68743031 |
| Molecular Formula | C15H19ClF3N3O3 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])NC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H19ClF3N3O3/c1-22(2,3)8-10(7-13(23)24)20-14(25)21-12-6-9(15(17,18)19)4-5-11(12)16/h4-6,10H,7-8H2,1-3H3,(H2-,20,21,23,24,25) |
| InChIKey | PRHYGPVVQPVBNZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|