C31H39N3O2 — CID 68743337
3-[2-[(dimethylamino)methyl]-4-methoxyphenyl]-1-[3-[3-(dimethylamino)propylamino]-5-(2-methylphenyl)phenyl]prop-2-en-1-one (PubChem CID 68743337) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]-4-methoxyphenyl]-1-[3-[3-(dimethylamino)propylamino]-5-(2-methylphenyl)phenyl]prop-2-en-1-one.
| Compound Name | 3-[2-[(dimethylamino)methyl]-4-methoxyphenyl]-1-[3-[3-(dimethylamino)propylamino]-5-(2-methylphenyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68743337 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]-4-methoxyphenyl]-1-[3-[3-(dimethylamino)propylamino]-5-(2-methylphenyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc(NCCCN(C)C)cc(-c3ccccc3C)c2)c(CN(C)C)c1 |
| InChI | InChI=1S/C31H39N3O2/c1-23-10-7-8-11-30(23)25-18-26(20-28(19-25)32-16-9-17-33(2)3)31(35)15-13-24-12-14-29(36-6)21-27(24)22-34(4)5/h7-8,10-15,18-21,32H,9,16-17,22H2,1-6H3 |
| InChIKey | QKWPJIJRNCCQOR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|