C23H31FN2O4S — CID 68748795
ethyl 5-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-1-(2-fluorophenyl)pyrazole-3-carboxylate (PubChem CID 68748795) has the molecular formula C23H31FN2O4S and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 5-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-1-(2-fluorophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-1-(2-fluorophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 68748795 |
| Molecular Formula | C23H31FN2O4S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | ethyl 5-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-1-(2-fluorophenyl)pyrazole-3-carboxylate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cc(C(=O)OCC)nn1-c1ccccc1F |
| InChI | InChI=1S/C23H31FN2O4S/c1-4-7-10-17(5-2)16-30-22(27)13-14-31-21-15-19(23(28)29-6-3)25-26(21)20-12-9-8-11-18(20)24/h8-9,11-12,15,17H,4-7,10,13-14,16H2,1-3H3 |
| InChIKey | XPSJQKRBVIPGGX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |