C20H24BrFN2O3 — CID 68750489
tert-butyl 4-[(4-bromofuran-2-yl)methyl]-2-(4-fluorophenyl)piperazine-1-carboxylate (PubChem CID 68750489) has the molecular formula C20H24BrFN2O3 and a molecular weight of 439.33 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromofuran-2-yl)methyl]-2-(4-fluorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromofuran-2-yl)methyl]-2-(4-fluorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68750489 |
| Molecular Formula | C20H24BrFN2O3 |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | tert-butyl 4-[(4-bromofuran-2-yl)methyl]-2-(4-fluorophenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(Br)co2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24BrFN2O3/c1-20(2,3)27-19(25)24-9-8-23(11-17-10-15(21)13-26-17)12-18(24)14-4-6-16(22)7-5-14/h4-7,10,13,18H,8-9,11-12H2,1-3H3 |
| InChIKey | YHQVZBZQUVWIKH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |