C23H29FN2O5 — CID 132778973
3-O-tert-butyl 10-O-ethyl 2-(4-fluorophenyl)-7-oxo-1,2,4,5,8,9-hexahydropyrido[1,2-d][1,4]diazepine-3,10-dicarboxylate (PubChem CID 132778973) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is 3-O-tert-butyl 10-O-ethyl 2-(4-fluorophenyl)-7-oxo-1,2,4,5,8,9-hexahydropyrido[1,2-d][1,4]diazepine-3,10-dicarboxylate.
| Compound Name | 3-O-tert-butyl 10-O-ethyl 2-(4-fluorophenyl)-7-oxo-1,2,4,5,8,9-hexahydropyrido[1,2-d][1,4]diazepine-3,10-dicarboxylate |
|---|---|
| PubChem CID | 132778973 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-O-tert-butyl 10-O-ethyl 2-(4-fluorophenyl)-7-oxo-1,2,4,5,8,9-hexahydropyrido[1,2-d][1,4]diazepine-3,10-dicarboxylate |
| SMILES | CCOC(=O)C1=C2CC(c3ccc(F)cc3)N(C(=O)OC(C)(C)C)CCN2C(=O)CC1 |
| InChI | InChI=1S/C23H29FN2O5/c1-5-30-21(28)17-10-11-20(27)25-12-13-26(22(29)31-23(2,3)4)18(14-19(17)25)15-6-8-16(24)9-7-15/h6-9,18H,5,10-14H2,1-4H3 |
| InChIKey | GWPZLZFYCIATBV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |