C27H28N6O — CID 68754492
N-[2-[[7-[4-(cyclobutylamino)phenyl]-6-phenylpyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]acetamide (PubChem CID 68754492) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[2-[[7-[4-(cyclobutylamino)phenyl]-6-phenylpyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[7-[4-(cyclobutylamino)phenyl]-6-phenylpyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 68754492 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[2-[[7-[4-(cyclobutylamino)phenyl]-6-phenylpyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ncc2cc(-c3ccccc3)c(-c3ccc(NC4CCC4)cc3)nc2n1 |
| InChI | InChI=1S/C27H28N6O/c1-18(34)28-14-15-29-27-30-17-21-16-24(19-6-3-2-4-7-19)25(32-26(21)33-27)20-10-12-23(13-11-20)31-22-8-5-9-22/h2-4,6-7,10-13,16-17,22,31H,5,8-9,14-15H2,1H3,(H,28,34)(H,29,30,32,33) |
| InChIKey | HUTNFNBWKYJHJJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|