C12H18FN3O7S — CID 68764851
(2S,5R)-2-(3-fluoropiperidin-4-yl)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid (PubChem CID 68764851) has the molecular formula C12H18FN3O7S and a molecular weight of 367.36 g/mol. Its IUPAC name is (2S,5R)-2-(3-fluoropiperidin-4-yl)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid.
| Compound Name | (2S,5R)-2-(3-fluoropiperidin-4-yl)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 68764851 |
| Molecular Formula | C12H18FN3O7S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2S,5R)-2-(3-fluoropiperidin-4-yl)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid |
| SMILES | O=C1N(OS(=O)(=O)O)[C@@H]2CC[C@@](C(=O)O)(C3CCNCC3F)N1C2 |
| InChI | InChI=1S/C12H18FN3O7S/c13-9-5-14-4-2-8(9)12(10(17)18)3-1-7-6-15(12)11(19)16(7)23-24(20,21)22/h7-9,14H,1-6H2,(H,17,18)(H,20,21,22)/t7-,8?,9?,12+/m1/s1 |
| InChIKey | UWHBWNHGIVNDFI-RQUNNUTMSA-N |
| XLogP | -0.61 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|