C13H22N4O7S — CID 90220302
[(2S,5R)-2-carbamoyl-7-oxo-2-(piperidin-4-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90220302) has the molecular formula C13H22N4O7S and a molecular weight of 378.41 g/mol. Its IUPAC name is [(2S,5R)-2-carbamoyl-7-oxo-2-(piperidin-4-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(piperidin-4-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90220302 |
| Molecular Formula | C13H22N4O7S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(piperidin-4-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)[C@@]1(OCC2CCNCC2)CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H22N4O7S/c14-11(18)13(23-8-9-2-5-15-6-3-9)4-1-10-7-16(13)12(19)17(10)24-25(20,21)22/h9-10,15H,1-8H2,(H2,14,18)(H,20,21,22)/t10-,13+/m1/s1 |
| InChIKey | LQTJLOPAUGCTPE-MFKMUULPSA-N |
| XLogP | -1.18 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|