C13H23N5O7S — CID 90220226
[(2S,5R)-2-carbamoyl-7-oxo-2-(2-piperazin-1-ylethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90220226) has the molecular formula C13H23N5O7S and a molecular weight of 393.42 g/mol. Its IUPAC name is [(2S,5R)-2-carbamoyl-7-oxo-2-(2-piperazin-1-ylethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(2-piperazin-1-ylethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90220226 |
| Molecular Formula | C13H23N5O7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(2-piperazin-1-ylethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)[C@@]1(OCCN2CCNCC2)CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H23N5O7S/c14-11(19)13(24-8-7-16-5-3-15-4-6-16)2-1-10-9-17(13)12(20)18(10)25-26(21,22)23/h10,15H,1-9H2,(H2,14,19)(H,21,22,23)/t10-,13+/m1/s1 |
| InChIKey | VSZVNZDSUUYINL-MFKMUULPSA-N |
| XLogP | -2.28 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|