C32H30N4OS — CID 68768104
(3Z)-3-[[1-(1,3-thiazol-4-ylmethyl)pyrazol-3-yl]methylidene]-1-tritylpiperidin-4-ol (PubChem CID 68768104) has the molecular formula C32H30N4OS and a molecular weight of 518.69 g/mol. Its IUPAC name is (3Z)-3-[[1-(1,3-thiazol-4-ylmethyl)pyrazol-3-yl]methylidene]-1-tritylpiperidin-4-ol.
| Compound Name | (3Z)-3-[[1-(1,3-thiazol-4-ylmethyl)pyrazol-3-yl]methylidene]-1-tritylpiperidin-4-ol |
|---|---|
| PubChem CID | 68768104 |
| Molecular Formula | C32H30N4OS |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (3Z)-3-[[1-(1,3-thiazol-4-ylmethyl)pyrazol-3-yl]methylidene]-1-tritylpiperidin-4-ol |
| SMILES | OC1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C/C1=C/c1ccn(Cc2cscn2)n1 |
| InChI | InChI=1S/C32H30N4OS/c37-31-17-18-35(21-25(31)20-29-16-19-36(34-29)22-30-23-38-24-33-30)32(26-10-4-1-5-11-26,27-12-6-2-7-13-27)28-14-8-3-9-15-28/h1-16,19-20,23-24,31,37H,17-18,21-22H2/b25-20- |
| InChIKey | GDRNWGJSJYUVOR-QQTULTPQSA-N |
| XLogP | 5.83 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|