C15H15ClN2O4S2 — CID 68782370
2-[[(Z)-1-(4-chlorophenyl)prop-1-en-2-yl]sulfonylamino]benzenesulfonamide (PubChem CID 68782370) has the molecular formula C15H15ClN2O4S2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-[[(Z)-1-(4-chlorophenyl)prop-1-en-2-yl]sulfonylamino]benzenesulfonamide.
| Compound Name | 2-[[(Z)-1-(4-chlorophenyl)prop-1-en-2-yl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 68782370 |
| Molecular Formula | C15H15ClN2O4S2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-[[(Z)-1-(4-chlorophenyl)prop-1-en-2-yl]sulfonylamino]benzenesulfonamide |
| SMILES | C/C(=C/c1ccc(Cl)cc1)S(=O)(=O)Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C15H15ClN2O4S2/c1-11(10-12-6-8-13(16)9-7-12)24(21,22)18-14-4-2-3-5-15(14)23(17,19)20/h2-10,18H,1H3,(H2,17,19,20)/b11-10- |
| InChIKey | RLJRHWYXJQHCIL-KHPPLWFESA-N |
| XLogP | 2.79 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |