C30H20N3O7+ — CID 68785758
bis[[4-(1,3-dioxoisoindol-2-yl)phenyl]methoxy]-oxoazanium (PubChem CID 68785758) has the molecular formula C30H20N3O7+ and a molecular weight of 534.50 g/mol. Its IUPAC name is bis[[4-(1,3-dioxoisoindol-2-yl)phenyl]methoxy]-oxoazanium.
| Compound Name | bis[[4-(1,3-dioxoisoindol-2-yl)phenyl]methoxy]-oxoazanium |
|---|---|
| PubChem CID | 68785758 |
| Molecular Formula | C30H20N3O7+ |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | bis[[4-(1,3-dioxoisoindol-2-yl)phenyl]methoxy]-oxoazanium |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(CO[N+](=O)OCc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H20N3O7/c34-27-23-5-1-2-6-24(23)28(35)31(27)21-13-9-19(10-14-21)17-39-33(38)40-18-20-11-15-22(16-12-20)32-29(36)25-7-3-4-8-26(25)30(32)37/h1-16H,17-18H2/q+1 |
| InChIKey | CPBCPZLYBFDFIQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|