C20H22O7S — CID 68794102
ethyl 2-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)-3-oxopropanoate (PubChem CID 68794102) has the molecular formula C20H22O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 2-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)-3-oxopropanoate.
| Compound Name | ethyl 2-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 68794102 |
| Molecular Formula | C20H22O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | ethyl 2-(3,4-dimethoxyphenyl)-3-(4-methylsulfonylphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)c1ccc(S(C)(=O)=O)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H22O7S/c1-5-27-20(22)18(14-8-11-16(25-2)17(12-14)26-3)19(21)13-6-9-15(10-7-13)28(4,23)24/h6-12,18H,5H2,1-4H3 |
| InChIKey | CDHGIJSBKIZTET-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|