C41H41N5O5S — CID 68802623
(4aS)-N-[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonyl-3-[(2-phenylphenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-8-carboxamide (PubChem CID 68802623) has the molecular formula C41H41N5O5S and a molecular weight of 715.88 g/mol. Its IUPAC name is (4aS)-N-[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonyl-3-[(2-phenylphenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-8-carboxamide.
| Compound Name | (4aS)-N-[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonyl-3-[(2-phenylphenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 68802623 |
| Molecular Formula | C41H41N5O5S |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 715.28 |
| IUPAC Name | (4aS)-N-[3-nitro-4-(3-phenylpropylamino)phenyl]sulfonyl-3-[(2-phenylphenyl)methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-8-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCCc2ccccc2)c([N+](=O)[O-])c1)c1ccc2c(c1)CC[C@H]1CN(Cc3ccccc3-c3ccccc3)CCN21 |
| InChI | InChI=1S/C41H41N5O5S/c47-41(43-52(50,51)36-20-21-38(40(27-36)46(48)49)42-23-9-12-30-10-3-1-4-11-30)33-18-22-39-32(26-33)17-19-35-29-44(24-25-45(35)39)28-34-15-7-8-16-37(34)31-13-5-2-6-14-31/h1-8,10-11,13-16,18,20-22,26-27,35,42H,9,12,17,19,23-25,28-29H2,(H,43,47)/t35-/m0/s1 |
| InChIKey | APLNBDKSFJWSIQ-DHUJRADRSA-N |
| XLogP | 7.06 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|