About CID 68827824
CID 68827824 (PubChem CID 68827824) has the molecular formula C13H13NOSi
and a molecular weight of 227.34 g/mol.
Molecular Properties
| Compound Name | CID 68827824 |
| PubChem CID | 68827824 |
| Molecular Formula | C13H13NOSi |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | — |
| SMILES | CO[Si]N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13NOSi/c1-15-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | VUELXQLWLBTLPX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68827824 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68827824?
The IUPAC name of CID 68827824 (CID 68827824) is not available.
What is the SMILES notation for CID 68827824?
The canonical SMILES for CID 68827824 is CO[Si]N(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 68827824?
The InChIKey is VUELXQLWLBTLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NOSi/c1-15-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of CID 68827824?
CID 68827824 has a molecular weight of 227.34 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68827824 is sourced from PubChem (CID 68827824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).