C7H8N2O6S2 — CID 68829670
4,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid (PubChem CID 68829670) has the molecular formula C7H8N2O6S2 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 68829670 |
| Molecular Formula | C7H8N2O6S2 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 4,6-bis(methylsulfonyl)pyrimidine-5-carboxylic acid |
| SMILES | CS(=O)(=O)c1ncnc(S(C)(=O)=O)c1C(=O)O |
| InChI | InChI=1S/C7H8N2O6S2/c1-16(12,13)5-4(7(10)11)6(9-3-8-5)17(2,14)15/h3H,1-2H3,(H,10,11) |
| InChIKey | NCEWGEOPSSQPHH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |