C44H49NO6S — CID 68832341
(3R,4R,5S)-4-[4-[(4R)-4-methoxypentoxy]phenyl]-1-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)piperidin-3-ol (PubChem CID 68832341) has the molecular formula C44H49NO6S and a molecular weight of 719.94 g/mol. Its IUPAC name is (3R,4R,5S)-4-[4-[(4R)-4-methoxypentoxy]phenyl]-1-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)piperidin-3-ol.
| Compound Name | (3R,4R,5S)-4-[4-[(4R)-4-methoxypentoxy]phenyl]-1-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 68832341 |
| Molecular Formula | C44H49NO6S |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | (3R,4R,5S)-4-[4-[(4R)-4-methoxypentoxy]phenyl]-1-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)piperidin-3-ol |
| SMILES | CO[C@H](C)CCCOc1ccc([C@H]2[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C44H49NO6S/c1-33-21-27-41(28-22-33)52(47,48)45-30-36(43(42(46)31-45)35-23-25-40(26-24-35)50-29-13-14-34(2)49-3)32-51-44(37-15-7-4-8-16-37,38-17-9-5-10-18-38)39-19-11-6-12-20-39/h4-12,15-28,34,36,42-43,46H,13-14,29-32H2,1-3H3/t34-,36+,42+,43+/m1/s1 |
| InChIKey | IRTVGUUCCVOZSF-KOZAHLDSSA-N |
| XLogP | 7.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|