C32H47ClN2O4 — CID 68846044
benzyl N-[(2R,3S,5S)-3-amino-2-hydroxy-5-methyl-7-prop-2-enoxyheptyl]-N-[1-(3-tert-butylphenyl)cyclopropyl]carbamate;hydrochloride (PubChem CID 68846044) has the molecular formula C32H47ClN2O4 and a molecular weight of 559.19 g/mol. Its IUPAC name is benzyl N-[(2R,3S,5S)-3-amino-2-hydroxy-5-methyl-7-prop-2-enoxyheptyl]-N-[1-(3-tert-butylphenyl)cyclopropyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(2R,3S,5S)-3-amino-2-hydroxy-5-methyl-7-prop-2-enoxyheptyl]-N-[1-(3-tert-butylphenyl)cyclopropyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 68846044 |
| Molecular Formula | C32H47ClN2O4 |
| Molecular Weight | 559.19 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | benzyl N-[(2R,3S,5S)-3-amino-2-hydroxy-5-methyl-7-prop-2-enoxyheptyl]-N-[1-(3-tert-butylphenyl)cyclopropyl]carbamate;hydrochloride |
| SMILES | C=CCOCC[C@@H](C)C[C@H](N)[C@H](O)CN(C(=O)OCc1ccccc1)C1(c2cccc(C(C)(C)C)c2)CC1.Cl |
| InChI | InChI=1S/C32H46N2O4.ClH/c1-6-18-37-19-15-24(2)20-28(33)29(35)22-34(30(36)38-23-25-11-8-7-9-12-25)32(16-17-32)27-14-10-13-26(21-27)31(3,4)5;/h6-14,21,24,28-29,35H,1,15-20,22-23,33H2,2-5H3;1H/t24-,28+,29-;/m1./s1 |
| InChIKey | KDIJSKKQVICMPC-SZZRBMOZSA-N |
| XLogP | 6.34 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.19 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|