C24H29N5O2 — CID 68847693
benzyl N-[[4-[[4-(methylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]carbamate (PubChem CID 68847693) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is benzyl N-[[4-[[4-(methylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[[4-(methylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 68847693 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | benzyl N-[[4-[[4-(methylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]carbamate |
| SMILES | CNc1nc(NC2CCC(CNC(=O)OCc3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H29N5O2/c1-25-22-20-9-5-6-10-21(20)28-23(29-22)27-19-13-11-17(12-14-19)15-26-24(30)31-16-18-7-3-2-4-8-18/h2-10,17,19H,11-16H2,1H3,(H,26,30)(H2,25,27,28,29) |
| InChIKey | LPHJQLIDKBWGHQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |