C18H30N3O6S+ — CID 68850296
(2R,4R)-2-(aminomethyl)-1-tert-butyl-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 68850296) has the molecular formula C18H30N3O6S+ and a molecular weight of 416.52 g/mol. Its IUPAC name is (2R,4R)-2-(aminomethyl)-1-tert-butyl-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R,4R)-2-(aminomethyl)-1-tert-butyl-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 68850296 |
| Molecular Formula | C18H30N3O6S+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R,4R)-2-(aminomethyl)-1-tert-butyl-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@@H]2C[C@H](CN)[N+](C(=O)O)(C(C)(C)C)C2)c1 |
| InChI | InChI=1S/C18H29N3O6S/c1-18(2,3)21(17(22)23)11-12(8-13(21)10-19)20-28(24,25)16-9-14(26-4)6-7-15(16)27-5/h6-7,9,12-13,20H,8,10-11,19H2,1-5H3/p+1/t12-,13-,21?/m1/s1 |
| InChIKey | QKRQEZOMMZXUPP-AZWPRIFCSA-O |
| XLogP | 1.38 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|