C15H21N5O5S — CID 74406521
[1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methylurea (PubChem CID 74406521) has the molecular formula C15H21N5O5S and a molecular weight of 383.43 g/mol. Its IUPAC name is [1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methylurea.
| Compound Name | [1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methylurea |
|---|---|
| PubChem CID | 74406521 |
| Molecular Formula | C15H21N5O5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methylurea |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC2CC(CNC(N)=O)N(C#N)C2)c1 |
| InChI | InChI=1S/C15H21N5O5S/c1-24-12-3-4-13(25-2)14(6-12)26(22,23)19-10-5-11(7-18-15(17)21)20(8-10)9-16/h3-4,6,10-11,19H,5,7-8H2,1-2H3,(H3,17,18,21) |
| InChIKey | NBDBFIHUZJPIMN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|