C18H27N5O6S — CID 76641173
1-[[1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(2-methoxyethyl)urea (PubChem CID 76641173) has the molecular formula C18H27N5O6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-[[1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[[1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 76641173 |
| Molecular Formula | C18H27N5O6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[[1-cyano-4-[(2,5-dimethoxyphenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NCC1CC(NS(=O)(=O)c2cc(OC)ccc2OC)CN1C#N |
| InChI | InChI=1S/C18H27N5O6S/c1-27-7-6-20-18(24)21-10-14-8-13(11-23(14)12-19)22-30(25,26)17-9-15(28-2)4-5-16(17)29-3/h4-5,9,13-14,22H,6-8,10-11H2,1-3H3,(H2,20,21,24) |
| InChIKey | HOKPIVWEWXGAEM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|