C22H23N3O8S — CID 68993872
(2R,4R)-4-[(2,5-dimethoxyphenyl)sulfonylamino]-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 68993872) has the molecular formula C22H23N3O8S and a molecular weight of 489.51 g/mol. Its IUPAC name is (2R,4R)-4-[(2,5-dimethoxyphenyl)sulfonylamino]-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4R)-4-[(2,5-dimethoxyphenyl)sulfonylamino]-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68993872 |
| Molecular Formula | C22H23N3O8S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (2R,4R)-4-[(2,5-dimethoxyphenyl)sulfonylamino]-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@@H]2C[C@H](CN3C(=O)c4ccccc4C3=O)N(C(=O)O)C2)c1 |
| InChI | InChI=1S/C22H23N3O8S/c1-32-15-7-8-18(33-2)19(10-15)34(30,31)23-13-9-14(24(11-13)22(28)29)12-25-20(26)16-5-3-4-6-17(16)21(25)27/h3-8,10,13-14,23H,9,11-12H2,1-2H3,(H,28,29)/t13-,14-/m1/s1 |
| InChIKey | PAMVKILKSRLHDC-ZIAGYGMSSA-N |
| XLogP | 1.40 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|