C12H21N2O5P — CID 68853876
6-(5-methoxy-3-pyridinyl)hex-5-en-3-amine;phosphoric acid (PubChem CID 68853876) has the molecular formula C12H21N2O5P and a molecular weight of 304.28 g/mol. Its IUPAC name is 6-(5-methoxy-3-pyridinyl)hex-5-en-3-amine;phosphoric acid.
| Compound Name | 6-(5-methoxy-3-pyridinyl)hex-5-en-3-amine;phosphoric acid |
|---|---|
| PubChem CID | 68853876 |
| Molecular Formula | C12H21N2O5P |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-(5-methoxy-3-pyridinyl)hex-5-en-3-amine;phosphoric acid |
| SMILES | CCC(N)CC=Cc1cncc(OC)c1.O=P(O)(O)O |
| InChI | InChI=1S/C12H18N2O.H3O4P/c1-3-11(13)6-4-5-10-7-12(15-2)9-14-8-10;1-5(2,3)4/h4-5,7-9,11H,3,6,13H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | ITEJLWRRYNQVTO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|