C20H25Cl2N4O6P — CID 68865291
N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 68865291) has the molecular formula C20H25Cl2N4O6P and a molecular weight of 519.32 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 68865291 |
| Molecular Formula | C20H25Cl2N4O6P |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1.O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C13H10N2O4.C7H15Cl2N2O2P/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-4,9H,5-6H2,(H,14,16,17);1-7H2,(H,10,12) |
| InChIKey | BGBDMCDCRHNHPA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|