C16H22O3SSi — CID 68866653
[3-(benzenesulfonyl)cyclohepta-2,4-dien-1-yl]oxy-trimethylsilane (PubChem CID 68866653) has the molecular formula C16H22O3SSi and a molecular weight of 322.50 g/mol. Its IUPAC name is [3-(benzenesulfonyl)cyclohepta-2,4-dien-1-yl]oxy-trimethylsilane.
| Compound Name | [3-(benzenesulfonyl)cyclohepta-2,4-dien-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 68866653 |
| Molecular Formula | C16H22O3SSi |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [3-(benzenesulfonyl)cyclohepta-2,4-dien-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1C=C(S(=O)(=O)c2ccccc2)C=CCC1 |
| InChI | InChI=1S/C16H22O3SSi/c1-21(2,3)19-14-9-7-8-12-16(13-14)20(17,18)15-10-5-4-6-11-15/h4-6,8,10-14H,7,9H2,1-3H3 |
| InChIKey | BRNQPISTYIYZSK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|