C30H31N3O7 — CID 68879750
[4-[7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanehydrazonate (PubChem CID 68879750) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is [4-[7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanehydrazonate.
| Compound Name | [4-[7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanehydrazonate |
|---|---|
| PubChem CID | 68879750 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | [4-[7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] (2S)-2-amino-3-(4-hydroxyphenyl)propanehydrazonate |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(OC(=NN)[C@@H](N)Cc3ccc(O)cc3)c(OC)c2)ccc1O |
| InChI | InChI=1S/C30H31N3O7/c1-38-28-16-20(7-13-26(28)37)5-11-23(35)18-24(36)12-6-21-8-14-27(29(17-21)39-2)40-30(33-32)25(31)15-19-3-9-22(34)10-4-19/h3-14,16-17,25,34,37H,15,18,31-32H2,1-2H3/t25-/m0/s1 |
| InChIKey | QDWALSGZHKNLMD-VWLOTQADSA-N |
| XLogP | 3.59 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|