C29H36N2O3 — CID 68880889
N-[2-[(3R,5R)-3,5-dibenzoyl-4-cyclohexylpiperidin-1-yl]ethyl]acetamide (PubChem CID 68880889) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[2-[(3R,5R)-3,5-dibenzoyl-4-cyclohexylpiperidin-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[(3R,5R)-3,5-dibenzoyl-4-cyclohexylpiperidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 68880889 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | N-[2-[(3R,5R)-3,5-dibenzoyl-4-cyclohexylpiperidin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1C[C@H](C(=O)c2ccccc2)C(C2CCCCC2)[C@@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H36N2O3/c1-21(32)30-17-18-31-19-25(28(33)23-13-7-3-8-14-23)27(22-11-5-2-6-12-22)26(20-31)29(34)24-15-9-4-10-16-24/h3-4,7-10,13-16,22,25-27H,2,5-6,11-12,17-20H2,1H3,(H,30,32)/t25-,26-/m0/s1 |
| InChIKey | FVFHKZXPXNIMFB-UIOOFZCWSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |