C24H23NO5S — CID 68882639
3-[2-[4-[[2-(1-benzothiophen-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]ethoxy]propanoic acid (PubChem CID 68882639) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[2-[4-[[2-(1-benzothiophen-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]ethoxy]propanoic acid.
| Compound Name | 3-[2-[4-[[2-(1-benzothiophen-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 68882639 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[2-[4-[[2-(1-benzothiophen-2-yl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]ethoxy]propanoic acid |
| SMILES | Cc1oc(-c2cc3ccccc3s2)nc1COc1ccc(CCOCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H23NO5S/c1-16-20(25-24(30-16)22-14-18-4-2-3-5-21(18)31-22)15-29-19-8-6-17(7-9-19)10-12-28-13-11-23(26)27/h2-9,14H,10-13,15H2,1H3,(H,26,27) |
| InChIKey | IILQTXNBDFLTEM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|