C19H19FN4 — CID 68910804
2-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[(4-fluorophenyl)methyl]benzene-1,3-diamine (PubChem CID 68910804) has the molecular formula C19H19FN4 and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[(4-fluorophenyl)methyl]benzene-1,3-diamine.
| Compound Name | 2-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[(4-fluorophenyl)methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 68910804 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[(4-fluorophenyl)methyl]benzene-1,3-diamine |
| SMILES | Nc1cccc(NCc2ccc(F)cc2)c1-c1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C19H19FN4/c20-14-8-4-12(5-9-14)11-22-16-3-1-2-15(21)19(16)18-10-17(23-24-18)13-6-7-13/h1-5,8-10,13,22H,6-7,11,21H2,(H,23,24) |
| InChIKey | MTZBJBOFWQHBGI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|