C19H22FN3O2 — CID 68918230
N-(4-fluoroanilino)-N'-(4-methoxyphenyl)-3,3-dimethyl-2-oxobutanimidamide (PubChem CID 68918230) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(4-fluoroanilino)-N'-(4-methoxyphenyl)-3,3-dimethyl-2-oxobutanimidamide.
| Compound Name | N-(4-fluoroanilino)-N'-(4-methoxyphenyl)-3,3-dimethyl-2-oxobutanimidamide |
|---|---|
| PubChem CID | 68918230 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-(4-fluoroanilino)-N'-(4-methoxyphenyl)-3,3-dimethyl-2-oxobutanimidamide |
| SMILES | COc1ccc(/N=C(/NNc2ccc(F)cc2)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-19(2,3)17(24)18(21-14-9-11-16(25-4)12-10-14)23-22-15-7-5-13(20)6-8-15/h5-12,22H,1-4H3,(H,21,23) |
| InChIKey | QJJAHWATNQZPBM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|