C13H16O7 — CID 68926664
3-hydroxypentanoic acid;phthalic acid (PubChem CID 68926664) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-hydroxypentanoic acid;phthalic acid.
| Compound Name | 3-hydroxypentanoic acid;phthalic acid |
|---|---|
| PubChem CID | 68926664 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-hydroxypentanoic acid;phthalic acid |
| SMILES | CCC(O)CC(=O)O.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C5H10O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-4(6)3-5(7)8/h1-4H,(H,9,10)(H,11,12);4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | YNHBYTGHOWAMDC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |