C31H28Cl2FN3O5 — CID 68948121
(3R)-6,8-dichloro-3-[[(2S)-2-[[2-(2-fluorophenyl)acetyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 68948121) has the molecular formula C31H28Cl2FN3O5 and a molecular weight of 612.49 g/mol. Its IUPAC name is (3R)-6,8-dichloro-3-[[(2S)-2-[[2-(2-fluorophenyl)acetyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | (3R)-6,8-dichloro-3-[[(2S)-2-[[2-(2-fluorophenyl)acetyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68948121 |
| Molecular Formula | C31H28Cl2FN3O5 |
| Molecular Weight | 612.49 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | (3R)-6,8-dichloro-3-[[(2S)-2-[[2-(2-fluorophenyl)acetyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | O=C(Cc1ccccc1F)N[C@@H](CCc1ccc(O)cc1)C(=O)N[C@]1(C(=O)O)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C31H28Cl2FN3O5/c32-19-14-21-22-16-31(30(41)42,12-11-25(22)36-28(21)23(33)15-19)37-29(40)26(10-7-17-5-8-20(38)9-6-17)35-27(39)13-18-3-1-2-4-24(18)34/h1-6,8-9,14-15,26,36,38H,7,10-13,16H2,(H,35,39)(H,37,40)(H,41,42)/t26-,31+/m0/s1 |
| InChIKey | FKLPPZGEQYCDFR-SUYBVONHSA-N |
| XLogP | 5.11 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|