C27H33N5O5 — CID 68950285
ethyl 4-[2-[4-[3-(1H-indazol-3-yl)prop-2-enoylamino]-2-methoxyphenoxy]ethylamino]piperidine-1-carboxylate (PubChem CID 68950285) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl 4-[2-[4-[3-(1H-indazol-3-yl)prop-2-enoylamino]-2-methoxyphenoxy]ethylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-[3-(1H-indazol-3-yl)prop-2-enoylamino]-2-methoxyphenoxy]ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68950285 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | ethyl 4-[2-[4-[3-(1H-indazol-3-yl)prop-2-enoylamino]-2-methoxyphenoxy]ethylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCOc2ccc(NC(=O)C=Cc3n[nH]c4ccccc34)cc2OC)CC1 |
| InChI | InChI=1S/C27H33N5O5/c1-3-36-27(34)32-15-12-19(13-16-32)28-14-17-37-24-10-8-20(18-25(24)35-2)29-26(33)11-9-23-21-6-4-5-7-22(21)30-31-23/h4-11,18-19,28H,3,12-17H2,1-2H3,(H,29,33)(H,30,31) |
| InChIKey | CKXNSRXGWGIMBK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|