C4H5NO3S — CID 68952111
5-hydroxy-2H-1,3-thiazole-3-carboxylic acid (PubChem CID 68952111) has the molecular formula C4H5NO3S and a molecular weight of 147.16 g/mol. Its IUPAC name is 5-hydroxy-2H-1,3-thiazole-3-carboxylic acid.
| Compound Name | 5-hydroxy-2H-1,3-thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68952111 |
| Molecular Formula | C4H5NO3S |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.00 |
| IUPAC Name | 5-hydroxy-2H-1,3-thiazole-3-carboxylic acid |
| SMILES | O=C(O)N1C=C(O)SC1 |
| InChI | InChI=1S/C4H5NO3S/c6-3-1-5(2-9-3)4(7)8/h1,6H,2H2,(H,7,8) |
| InChIKey | WAHCCECQVKUYMH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |