C30H26N2O2 — CID 68958334
[4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate (PubChem CID 68958334) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate.
| Compound Name | [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate |
|---|---|
| PubChem CID | 68958334 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate |
| SMILES | Cc1cc(Cc2ccc3cc(Cc4cc(C)c(OC#N)c(C)c4)ccc3c2)cc(C)c1OC#N |
| InChI | InChI=1S/C30H26N2O2/c1-19-9-25(10-20(2)29(19)33-17-31)13-23-5-7-28-16-24(6-8-27(28)15-23)14-26-11-21(3)30(34-18-32)22(4)12-26/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | OSRVRAGJHCPTGU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|