About [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate
[4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate (PubChem CID 68958334) has the molecular formula C30H26N2O2
and a molecular weight of 446.55 g/mol. Its IUPAC name is [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate.
Molecular Properties
| Compound Name | [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate |
| PubChem CID | 68958334 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate |
| SMILES | Cc1cc(Cc2ccc3cc(Cc4cc(C)c(OC#N)c(C)c4)ccc3c2)cc(C)c1OC#N |
| InChI | InChI=1S/C30H26N2O2/c1-19-9-25(10-20(2)29(19)33-17-31)13-23-5-7-28-16-24(6-8-27(28)15-23)14-26-11-21(3)30(34-18-32)22(4)12-26/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | OSRVRAGJHCPTGU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate?
The IUPAC name of [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate (CID 68958334) is [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate.
What is the SMILES notation for [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate?
The canonical SMILES for [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate is Cc1cc(Cc2ccc3cc(Cc4cc(C)c(OC#N)c(C)c4)ccc3c2)cc(C)c1OC#N.
What is the InChIKey of [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate?
The InChIKey is OSRVRAGJHCPTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26N2O2/c1-19-9-25(10-20(2)29(19)33-17-31)13-23-5-7-28-16-24(6-8-27(28)15-23)14-26-11-21(3)30(34-18-32)22(4)12-26/h5-12,15-16H,13-14H2,1-4H3.
What are the key properties of [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate?
[4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate has a molecular weight of 446.55 g/mol, XLogP of 6.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[6-[(4-cyanato-3,5-dimethylphenyl)methyl]naphthalen-2-yl]methyl]-2,6-dimethylphenyl] cyanate is sourced from PubChem (CID 68958334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).