C21H25NO4 — CID 68965930
4-oxo-4-[1-(pentanoylamino)-4-phenylcyclohexa-2,5-dien-1-yl]butanoic acid (PubChem CID 68965930) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-oxo-4-[1-(pentanoylamino)-4-phenylcyclohexa-2,5-dien-1-yl]butanoic acid.
| Compound Name | 4-oxo-4-[1-(pentanoylamino)-4-phenylcyclohexa-2,5-dien-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68965930 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-oxo-4-[1-(pentanoylamino)-4-phenylcyclohexa-2,5-dien-1-yl]butanoic acid |
| SMILES | CCCCC(=O)NC1(C(=O)CCC(=O)O)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C21H25NO4/c1-2-3-9-19(24)22-21(18(23)10-11-20(25)26)14-12-17(13-15-21)16-7-5-4-6-8-16/h4-8,12-15,17H,2-3,9-11H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | XBOVZIPZKCZYPM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|