About 2-phenylethylbenzene;phosphorosooxybenzene
2-phenylethylbenzene;phosphorosooxybenzene (PubChem CID 68973747) has the molecular formula C20H19O2P
and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-phenylethylbenzene;phosphorosooxybenzene.
Molecular Properties
| Compound Name | 2-phenylethylbenzene;phosphorosooxybenzene |
| PubChem CID | 68973747 |
| Molecular Formula | C20H19O2P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-phenylethylbenzene;phosphorosooxybenzene |
| SMILES | O=POc1ccccc1.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C6H5O2P/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;7-9-8-6-4-2-1-3-5-6/h1-10H,11-12H2;1-5H |
| InChIKey | GPHCRTIIOIVQOI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethylbenzene;phosphorosooxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethylbenzene;phosphorosooxybenzene?
The IUPAC name of 2-phenylethylbenzene;phosphorosooxybenzene (CID 68973747) is 2-phenylethylbenzene;phosphorosooxybenzene.
What is the SMILES notation for 2-phenylethylbenzene;phosphorosooxybenzene?
The canonical SMILES for 2-phenylethylbenzene;phosphorosooxybenzene is O=POc1ccccc1.c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of 2-phenylethylbenzene;phosphorosooxybenzene?
The InChIKey is GPHCRTIIOIVQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C6H5O2P/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;7-9-8-6-4-2-1-3-5-6/h1-10H,11-12H2;1-5H.
What are the key properties of 2-phenylethylbenzene;phosphorosooxybenzene?
2-phenylethylbenzene;phosphorosooxybenzene has a molecular weight of 322.34 g/mol, XLogP of 5.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethylbenzene;phosphorosooxybenzene is sourced from PubChem (CID 68973747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).