C35H36ClN5 — CID 68975887
2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-N-[(1,5-diphenylpyrazol-3-yl)methyl]ethanamine (PubChem CID 68975887) has the molecular formula C35H36ClN5 and a molecular weight of 562.16 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-N-[(1,5-diphenylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-N-[(1,5-diphenylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 68975887 |
| Molecular Formula | C35H36ClN5 |
| Molecular Weight | 562.16 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-N-[(1,5-diphenylpyrazol-3-yl)methyl]ethanamine |
| SMILES | Clc1ccc(C(c2ccccc2)N2CCN(CCNCc3cc(-c4ccccc4)n(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C35H36ClN5/c36-31-18-16-30(17-19-31)35(29-12-6-2-7-13-29)40-24-22-39(23-25-40)21-20-37-27-32-26-34(28-10-4-1-5-11-28)41(38-32)33-14-8-3-9-15-33/h1-19,26,35,37H,20-25,27H2 |
| InChIKey | XQPRJORAIVEDKU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.16 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|