C12H16O15 — CID 68987716
2-carboxyoxyethyl hydrogen carbonate;1-carboxyoxypropan-2-yl hydrogen carbonate;1,3-dioxol-2-one (PubChem CID 68987716) has the molecular formula C12H16O15 and a molecular weight of 400.25 g/mol. Its IUPAC name is 2-carboxyoxyethyl hydrogen carbonate;1-carboxyoxypropan-2-yl hydrogen carbonate;1,3-dioxol-2-one.
| Compound Name | 2-carboxyoxyethyl hydrogen carbonate;1-carboxyoxypropan-2-yl hydrogen carbonate;1,3-dioxol-2-one |
|---|---|
| PubChem CID | 68987716 |
| Molecular Formula | C12H16O15 |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-carboxyoxyethyl hydrogen carbonate;1-carboxyoxypropan-2-yl hydrogen carbonate;1,3-dioxol-2-one |
| SMILES | CC(COC(=O)O)OC(=O)O.O=C(O)OCCOC(=O)O.O=c1occo1 |
| InChI | InChI=1S/C5H8O6.C4H6O6.C3H2O3/c1-3(11-5(8)9)2-10-4(6)7;5-3(6)9-1-2-10-4(7)8;4-3-5-1-2-6-3/h3H,2H2,1H3,(H,6,7)(H,8,9);1-2H2,(H,5,6)(H,7,8);1-2H |
| InChIKey | CLAMBKRDRCYBDP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 229.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|