C25H34N4O5 — CID 69002748
ditert-butyl 2-[dipyridin-2-ylcarbamoyl(methyl)amino]pentanedioate (PubChem CID 69002748) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is ditert-butyl 2-[dipyridin-2-ylcarbamoyl(methyl)amino]pentanedioate.
| Compound Name | ditert-butyl 2-[dipyridin-2-ylcarbamoyl(methyl)amino]pentanedioate |
|---|---|
| PubChem CID | 69002748 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | ditert-butyl 2-[dipyridin-2-ylcarbamoyl(methyl)amino]pentanedioate |
| SMILES | CN(C(=O)N(c1ccccn1)c1ccccn1)C(CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34N4O5/c1-24(2,3)33-21(30)15-14-18(22(31)34-25(4,5)6)28(7)23(32)29(19-12-8-10-16-26-19)20-13-9-11-17-27-20/h8-13,16-18H,14-15H2,1-7H3 |
| InChIKey | CCOSPHODTUOHIO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |