C19H22BrN3O4S — CID 6900515
N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide (PubChem CID 6900515) has the molecular formula C19H22BrN3O4S and a molecular weight of 468.37 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 6900515 |
| Molecular Formula | C19H22BrN3O4S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)N/N=C/c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C19H22BrN3O4S/c1-4-23(5-2)28(25,26)17-8-6-7-14(12-17)19(24)22-21-13-15-11-16(20)9-10-18(15)27-3/h6-13H,4-5H2,1-3H3,(H,22,24)/b21-13+ |
| InChIKey | WDDZOYVIVXLWAM-FYJGNVAPSA-N |
| XLogP | 3.25 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|