About tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate
tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate (PubChem CID 69012079) has the molecular formula C22H39NO11Si
and a molecular weight of 521.64 g/mol. Its IUPAC name is tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate |
| PubChem CID | 69012079 |
| Molecular Formula | C22H39NO11Si |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate |
| SMILES | COC(C)OC(C)O[Si](COC(=O)c1ccccn1)(OC(C)OC(C)OC)OC(C)OC(C)OC |
| InChI | InChI=1S/C22H39NO11Si/c1-15(25-7)29-18(4)32-35(33-19(5)30-16(2)26-8,34-20(6)31-17(3)27-9)14-28-22(24)21-12-10-11-13-23-21/h10-13,15-20H,14H2,1-9H3 |
| InChIKey | XSKRACCRAMGPFD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate?
The IUPAC name of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate (CID 69012079) is tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate.
What is the SMILES notation for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate?
The canonical SMILES for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate is COC(C)OC(C)O[Si](COC(=O)c1ccccn1)(OC(C)OC(C)OC)OC(C)OC(C)OC.
What is the InChIKey of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate?
The InChIKey is XSKRACCRAMGPFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NO11Si/c1-15(25-7)29-18(4)32-35(33-19(5)30-16(2)26-8,34-20(6)31-17(3)27-9)14-28-22(24)21-12-10-11-13-23-21/h10-13,15-20H,14H2,1-9H3.
What are the key properties of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate?
tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate has a molecular weight of 521.64 g/mol, XLogP of 2.83, 18 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl pyridine-2-carboxylate is sourced from PubChem (CID 69012079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).