About tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate
tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate (PubChem CID 68836430) has the molecular formula C23H41NO11Si
and a molecular weight of 535.66 g/mol. Its IUPAC name is tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate.
Molecular Properties
| Compound Name | tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate |
| PubChem CID | 68836430 |
| Molecular Formula | C23H41NO11Si |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate |
| SMILES | COC(C)OC(C)O[Si](COC(=O)Cc1ccccn1)(OC(C)OC(C)OC)OC(C)OC(C)OC |
| InChI | InChI=1S/C23H41NO11Si/c1-16(26-7)30-19(4)33-36(34-20(5)31-17(2)27-8,35-21(6)32-18(3)28-9)15-29-23(25)14-22-12-10-11-13-24-22/h10-13,16-21H,14-15H2,1-9H3 |
| InChIKey | QAAFRYGERIUORL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate?
The IUPAC name of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate (CID 68836430) is tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate.
What is the SMILES notation for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate?
The canonical SMILES for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate is COC(C)OC(C)O[Si](COC(=O)Cc1ccccn1)(OC(C)OC(C)OC)OC(C)OC(C)OC.
What is the InChIKey of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate?
The InChIKey is QAAFRYGERIUORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41NO11Si/c1-16(26-7)30-19(4)33-36(34-20(5)31-17(2)27-8,35-21(6)32-18(3)28-9)15-29-23(25)14-22-12-10-11-13-24-22/h10-13,16-21H,14-15H2,1-9H3.
What are the key properties of tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate?
tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate has a molecular weight of 535.66 g/mol, XLogP of 2.76, 19 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tris[1-(1-methoxyethoxy)ethoxy]silylmethyl 2-pyridin-2-ylacetate is sourced from PubChem (CID 68836430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).