About 1-diethoxysilylethyl 2-pyridin-2-ylacetate
1-diethoxysilylethyl 2-pyridin-2-ylacetate (PubChem CID 154185532) has the molecular formula C13H21NO4Si
and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-diethoxysilylethyl 2-pyridin-2-ylacetate.
Molecular Properties
| Compound Name | 1-diethoxysilylethyl 2-pyridin-2-ylacetate |
| PubChem CID | 154185532 |
| Molecular Formula | C13H21NO4Si |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-diethoxysilylethyl 2-pyridin-2-ylacetate |
| SMILES | CCO[SiH](OCC)C(C)OC(=O)Cc1ccccn1 |
| InChI | InChI=1S/C13H21NO4Si/c1-4-16-19(17-5-2)11(3)18-13(15)10-12-8-6-7-9-14-12/h6-9,11,19H,4-5,10H2,1-3H3 |
| InChIKey | HYYIXNZTAKUHHW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxysilylethyl 2-pyridin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxysilylethyl 2-pyridin-2-ylacetate?
The IUPAC name of 1-diethoxysilylethyl 2-pyridin-2-ylacetate (CID 154185532) is 1-diethoxysilylethyl 2-pyridin-2-ylacetate.
What is the SMILES notation for 1-diethoxysilylethyl 2-pyridin-2-ylacetate?
The canonical SMILES for 1-diethoxysilylethyl 2-pyridin-2-ylacetate is CCO[SiH](OCC)C(C)OC(=O)Cc1ccccn1.
What is the InChIKey of 1-diethoxysilylethyl 2-pyridin-2-ylacetate?
The InChIKey is HYYIXNZTAKUHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO4Si/c1-4-16-19(17-5-2)11(3)18-13(15)10-12-8-6-7-9-14-12/h6-9,11,19H,4-5,10H2,1-3H3.
What are the key properties of 1-diethoxysilylethyl 2-pyridin-2-ylacetate?
1-diethoxysilylethyl 2-pyridin-2-ylacetate has a molecular weight of 283.40 g/mol, XLogP of 1.39, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxysilylethyl 2-pyridin-2-ylacetate is sourced from PubChem (CID 154185532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).