C28H35N5O3 — CID 69029132
4-[[(4-amino-2-methylbutan-2-yl)-[(4-ethoxyphenyl)carbamoyl]amino]methyl]-N-(2-aminophenyl)benzamide (PubChem CID 69029132) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 4-[[(4-amino-2-methylbutan-2-yl)-[(4-ethoxyphenyl)carbamoyl]amino]methyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[[(4-amino-2-methylbutan-2-yl)-[(4-ethoxyphenyl)carbamoyl]amino]methyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 69029132 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 4-[[(4-amino-2-methylbutan-2-yl)-[(4-ethoxyphenyl)carbamoyl]amino]methyl]-N-(2-aminophenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)N(Cc2ccc(C(=O)Nc3ccccc3N)cc2)C(C)(C)CCN)cc1 |
| InChI | InChI=1S/C28H35N5O3/c1-4-36-23-15-13-22(14-16-23)31-27(35)33(28(2,3)17-18-29)19-20-9-11-21(12-10-20)26(34)32-25-8-6-5-7-24(25)30/h5-16H,4,17-19,29-30H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | FRVYEYJOPHSISK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|