C24H17ClN2O5S — CID 69050818
4-[5-(1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]benzamide (PubChem CID 69050818) has the molecular formula C24H17ClN2O5S and a molecular weight of 480.93 g/mol. Its IUPAC name is 4-[5-(1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]benzamide.
| Compound Name | 4-[5-(1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]benzamide |
|---|---|
| PubChem CID | 69050818 |
| Molecular Formula | C24H17ClN2O5S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 4-[5-(1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc4c(c3)OCO4)n(S(=O)(=O)c3cccc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C24H17ClN2O5S/c25-19-2-1-3-20(12-19)33(29,30)27-13-18(15-4-6-16(7-5-15)24(26)28)10-21(27)17-8-9-22-23(11-17)32-14-31-22/h1-13H,14H2,(H2,26,28) |
| InChIKey | PDZWCHWYXVKRCA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |